C20H23N3O2 — CID 134009641
3-(imidazo[1,2-a]pyridin-2-ylmethoxy)-N-pentylbenzamide (PubChem CID 134009641) has the molecular formula C20H23N3O2 and a molecular weight of 337.42 g/mol. Its IUPAC name is 3-(imidazo[1,2-a]pyridin-2-ylmethoxy)-N-pentylbenzamide.
| Compound Name | 3-(imidazo[1,2-a]pyridin-2-ylmethoxy)-N-pentylbenzamide |
|---|---|
| PubChem CID | 134009641 |
| Molecular Formula | C20H23N3O2 |
| Molecular Weight | 337.42 g/mol |
| Exact Mass | 337.18 |
| IUPAC Name | 3-(imidazo[1,2-a]pyridin-2-ylmethoxy)-N-pentylbenzamide |
| SMILES | CCCCCNC(=O)c1cccc(OCc2cn3ccccc3n2)c1 |
| InChI | InChI=1S/C20H23N3O2/c1-2-3-5-11-21-20(24)16-8-7-9-18(13-16)25-15-17-14-23-12-6-4-10-19(23)22-17/h4,6-10,12-14H,2-3,5,11,15H2,1H3,(H,21,24) |
| InChIKey | DTCWAKRTZTXHDV-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 55.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.42 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|