C19H22N4O2 — CID 119431980
3-(imidazo[1,2-a]pyridin-2-ylmethoxy)-N-[3-(methylamino)propyl]benzamide (PubChem CID 119431980) has the molecular formula C19H22N4O2 and a molecular weight of 338.41 g/mol. Its IUPAC name is 3-(imidazo[1,2-a]pyridin-2-ylmethoxy)-N-[3-(methylamino)propyl]benzamide.
| Compound Name | 3-(imidazo[1,2-a]pyridin-2-ylmethoxy)-N-[3-(methylamino)propyl]benzamide |
|---|---|
| PubChem CID | 119431980 |
| Molecular Formula | C19H22N4O2 |
| Molecular Weight | 338.41 g/mol |
| Exact Mass | 338.17 |
| IUPAC Name | 3-(imidazo[1,2-a]pyridin-2-ylmethoxy)-N-[3-(methylamino)propyl]benzamide |
| SMILES | CNCCCNC(=O)c1cccc(OCc2cn3ccccc3n2)c1 |
| InChI | InChI=1S/C19H22N4O2/c1-20-9-5-10-21-19(24)15-6-4-7-17(12-15)25-14-16-13-23-11-3-2-8-18(23)22-16/h2-4,6-8,11-13,20H,5,9-10,14H2,1H3,(H,21,24) |
| InChIKey | ORKYRPVBQXNGJO-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 67.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.41 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|