C24H23N3O3 — CID 30582719
3-(imidazo[1,2-a]pyridin-2-ylmethoxy)-N-[2-(3-methylphenoxy)ethyl]benzamide (PubChem CID 30582719) has the molecular formula C24H23N3O3 and a molecular weight of 401.47 g/mol. Its IUPAC name is 3-(imidazo[1,2-a]pyridin-2-ylmethoxy)-N-[2-(3-methylphenoxy)ethyl]benzamide.
| Compound Name | 3-(imidazo[1,2-a]pyridin-2-ylmethoxy)-N-[2-(3-methylphenoxy)ethyl]benzamide |
|---|---|
| PubChem CID | 30582719 |
| Molecular Formula | C24H23N3O3 |
| Molecular Weight | 401.47 g/mol |
| Exact Mass | 401.17 |
| IUPAC Name | 3-(imidazo[1,2-a]pyridin-2-ylmethoxy)-N-[2-(3-methylphenoxy)ethyl]benzamide |
| SMILES | Cc1cccc(OCCNC(=O)c2cccc(OCc3cn4ccccc4n3)c2)c1 |
| InChI | InChI=1S/C24H23N3O3/c1-18-6-4-8-21(14-18)29-13-11-25-24(28)19-7-5-9-22(15-19)30-17-20-16-27-12-3-2-10-23(27)26-20/h2-10,12,14-16H,11,13,17H2,1H3,(H,25,28) |
| InChIKey | HPWTVIIORKBFLW-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 64.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.47 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|