C26H25N3O2 — CID 55493250
3-(imidazo[1,2-a]pyridin-2-ylmethoxy)-N-[(1-phenylcyclobutyl)methyl]benzamide (PubChem CID 55493250) has the molecular formula C26H25N3O2 and a molecular weight of 411.51 g/mol. Its IUPAC name is 3-(imidazo[1,2-a]pyridin-2-ylmethoxy)-N-[(1-phenylcyclobutyl)methyl]benzamide.
| Compound Name | 3-(imidazo[1,2-a]pyridin-2-ylmethoxy)-N-[(1-phenylcyclobutyl)methyl]benzamide |
|---|---|
| PubChem CID | 55493250 |
| Molecular Formula | C26H25N3O2 |
| Molecular Weight | 411.51 g/mol |
| Exact Mass | 411.19 |
| IUPAC Name | 3-(imidazo[1,2-a]pyridin-2-ylmethoxy)-N-[(1-phenylcyclobutyl)methyl]benzamide |
| SMILES | O=C(NCC1(c2ccccc2)CCC1)c1cccc(OCc2cn3ccccc3n2)c1 |
| InChI | InChI=1S/C26H25N3O2/c30-25(27-19-26(13-7-14-26)21-9-2-1-3-10-21)20-8-6-11-23(16-20)31-18-22-17-29-15-5-4-12-24(29)28-22/h1-6,8-12,15-17H,7,13-14,18-19H2,(H,27,30) |
| InChIKey | MELVYKOIEYRSMY-UHFFFAOYSA-N |
| XLogP | 4.76 |
| TPSA | 55.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.51 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |