C16H18N2O4S2 — CID 119242448
2-[2-[[3-[(2-methyl-1,3-thiazol-4-yl)methoxy]benzoyl]amino]ethylsulfanyl]acetic acid (PubChem CID 119242448) has the molecular formula C16H18N2O4S2 and a molecular weight of 366.46 g/mol. Its IUPAC name is 2-[2-[[3-[(2-methyl-1,3-thiazol-4-yl)methoxy]benzoyl]amino]ethylsulfanyl]acetic acid.
| Compound Name | 2-[2-[[3-[(2-methyl-1,3-thiazol-4-yl)methoxy]benzoyl]amino]ethylsulfanyl]acetic acid |
|---|---|
| PubChem CID | 119242448 |
| Molecular Formula | C16H18N2O4S2 |
| Molecular Weight | 366.46 g/mol |
| Exact Mass | 366.07 |
| IUPAC Name | 2-[2-[[3-[(2-methyl-1,3-thiazol-4-yl)methoxy]benzoyl]amino]ethylsulfanyl]acetic acid |
| SMILES | Cc1nc(COc2cccc(C(=O)NCCSCC(=O)O)c2)cs1 |
| InChI | InChI=1S/C16H18N2O4S2/c1-11-18-13(9-24-11)8-22-14-4-2-3-12(7-14)16(21)17-5-6-23-10-15(19)20/h2-4,7,9H,5-6,8,10H2,1H3,(H,17,21)(H,19,20) |
| InChIKey | SLSJJFHJCWQASL-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 88.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.46 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|