C16H18N2O3S3 — CID 119241681
2-[2-[[4-[(2-methyl-1,3-thiazol-4-yl)methylsulfanyl]benzoyl]amino]ethylsulfanyl]acetic acid (PubChem CID 119241681) has the molecular formula C16H18N2O3S3 and a molecular weight of 382.53 g/mol. Its IUPAC name is 2-[2-[[4-[(2-methyl-1,3-thiazol-4-yl)methylsulfanyl]benzoyl]amino]ethylsulfanyl]acetic acid.
| Compound Name | 2-[2-[[4-[(2-methyl-1,3-thiazol-4-yl)methylsulfanyl]benzoyl]amino]ethylsulfanyl]acetic acid |
|---|---|
| PubChem CID | 119241681 |
| Molecular Formula | C16H18N2O3S3 |
| Molecular Weight | 382.53 g/mol |
| Exact Mass | 382.05 |
| IUPAC Name | 2-[2-[[4-[(2-methyl-1,3-thiazol-4-yl)methylsulfanyl]benzoyl]amino]ethylsulfanyl]acetic acid |
| SMILES | Cc1nc(CSc2ccc(C(=O)NCCSCC(=O)O)cc2)cs1 |
| InChI | InChI=1S/C16H18N2O3S3/c1-11-18-13(8-23-11)9-24-14-4-2-12(3-5-14)16(21)17-6-7-22-10-15(19)20/h2-5,8H,6-7,9-10H2,1H3,(H,17,21)(H,19,20) |
| InChIKey | MIAFPXBDOPNVNF-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 79.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.53 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|