C20H20N2O2S2 — CID 134024182
4-[(2-methyl-1,3-thiazol-4-yl)methylsulfanyl]-N-(2-phenoxyethyl)benzamide (PubChem CID 134024182) has the molecular formula C20H20N2O2S2 and a molecular weight of 384.53 g/mol. Its IUPAC name is 4-[(2-methyl-1,3-thiazol-4-yl)methylsulfanyl]-N-(2-phenoxyethyl)benzamide.
| Compound Name | 4-[(2-methyl-1,3-thiazol-4-yl)methylsulfanyl]-N-(2-phenoxyethyl)benzamide |
|---|---|
| PubChem CID | 134024182 |
| Molecular Formula | C20H20N2O2S2 |
| Molecular Weight | 384.53 g/mol |
| Exact Mass | 384.10 |
| IUPAC Name | 4-[(2-methyl-1,3-thiazol-4-yl)methylsulfanyl]-N-(2-phenoxyethyl)benzamide |
| SMILES | Cc1nc(CSc2ccc(C(=O)NCCOc3ccccc3)cc2)cs1 |
| InChI | InChI=1S/C20H20N2O2S2/c1-15-22-17(13-25-15)14-26-19-9-7-16(8-10-19)20(23)21-11-12-24-18-5-3-2-4-6-18/h2-10,13H,11-12,14H2,1H3,(H,21,23) |
| InChIKey | SPOWZIVZCMQYCC-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.53 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|