C20H27N3OS2 — CID 35410995
4-[(2-methyl-1,3-thiazol-4-yl)methylsulfanyl]-N-(3-piperidin-1-ylpropyl)benzamide (PubChem CID 35410995) has the molecular formula C20H27N3OS2 and a molecular weight of 389.59 g/mol. Its IUPAC name is 4-[(2-methyl-1,3-thiazol-4-yl)methylsulfanyl]-N-(3-piperidin-1-ylpropyl)benzamide.
| Compound Name | 4-[(2-methyl-1,3-thiazol-4-yl)methylsulfanyl]-N-(3-piperidin-1-ylpropyl)benzamide |
|---|---|
| PubChem CID | 35410995 |
| Molecular Formula | C20H27N3OS2 |
| Molecular Weight | 389.59 g/mol |
| Exact Mass | 389.16 |
| IUPAC Name | 4-[(2-methyl-1,3-thiazol-4-yl)methylsulfanyl]-N-(3-piperidin-1-ylpropyl)benzamide |
| SMILES | Cc1nc(CSc2ccc(C(=O)NCCCN3CCCCC3)cc2)cs1 |
| InChI | InChI=1S/C20H27N3OS2/c1-16-22-18(14-25-16)15-26-19-8-6-17(7-9-19)20(24)21-10-5-13-23-11-3-2-4-12-23/h6-9,14H,2-5,10-13,15H2,1H3,(H,21,24) |
| InChIKey | FOXVVYZSLPQJOH-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 45.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.59 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|