C15H18N2O2S2 — CID 24624877
N-(2-methoxyethyl)-4-[(2-methyl-1,3-thiazol-4-yl)methylsulfanyl]benzamide (PubChem CID 24624877) has the molecular formula C15H18N2O2S2 and a molecular weight of 322.46 g/mol. Its IUPAC name is N-(2-methoxyethyl)-4-[(2-methyl-1,3-thiazol-4-yl)methylsulfanyl]benzamide.
| Compound Name | N-(2-methoxyethyl)-4-[(2-methyl-1,3-thiazol-4-yl)methylsulfanyl]benzamide |
|---|---|
| PubChem CID | 24624877 |
| Molecular Formula | C15H18N2O2S2 |
| Molecular Weight | 322.46 g/mol |
| Exact Mass | 322.08 |
| IUPAC Name | N-(2-methoxyethyl)-4-[(2-methyl-1,3-thiazol-4-yl)methylsulfanyl]benzamide |
| SMILES | COCCNC(=O)c1ccc(SCc2csc(C)n2)cc1 |
| InChI | InChI=1S/C15H18N2O2S2/c1-11-17-13(9-20-11)10-21-14-5-3-12(4-6-14)15(18)16-7-8-19-2/h3-6,9H,7-8,10H2,1-2H3,(H,16,18) |
| InChIKey | XSHBPXLTCGRBDE-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.46 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|