C19H26N4OS2 — CID 119392239
4-[(2-methyl-1,3-thiazol-4-yl)methylsulfanyl]-N-(3-piperazin-1-ylpropyl)benzamide (PubChem CID 119392239) has the molecular formula C19H26N4OS2 and a molecular weight of 390.58 g/mol. Its IUPAC name is 4-[(2-methyl-1,3-thiazol-4-yl)methylsulfanyl]-N-(3-piperazin-1-ylpropyl)benzamide.
| Compound Name | 4-[(2-methyl-1,3-thiazol-4-yl)methylsulfanyl]-N-(3-piperazin-1-ylpropyl)benzamide |
|---|---|
| PubChem CID | 119392239 |
| Molecular Formula | C19H26N4OS2 |
| Molecular Weight | 390.58 g/mol |
| Exact Mass | 390.15 |
| IUPAC Name | 4-[(2-methyl-1,3-thiazol-4-yl)methylsulfanyl]-N-(3-piperazin-1-ylpropyl)benzamide |
| SMILES | Cc1nc(CSc2ccc(C(=O)NCCCN3CCNCC3)cc2)cs1 |
| InChI | InChI=1S/C19H26N4OS2/c1-15-22-17(13-25-15)14-26-18-5-3-16(4-6-18)19(24)21-7-2-10-23-11-8-20-9-12-23/h3-6,13,20H,2,7-12,14H2,1H3,(H,21,24) |
| InChIKey | AMRQEWCPFXJJOS-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 57.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.58 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|