C15H24ClN3OS — CID 119390747
4-methylsulfanyl-N-(3-piperazin-1-ylpropyl)benzamide;hydrochloride (PubChem CID 119390747) has the molecular formula C15H24ClN3OS and a molecular weight of 329.90 g/mol. Its IUPAC name is 4-methylsulfanyl-N-(3-piperazin-1-ylpropyl)benzamide;hydrochloride.
| Compound Name | 4-methylsulfanyl-N-(3-piperazin-1-ylpropyl)benzamide;hydrochloride |
|---|---|
| PubChem CID | 119390747 |
| Molecular Formula | C15H24ClN3OS |
| Molecular Weight | 329.90 g/mol |
| Exact Mass | 329.13 |
| IUPAC Name | 4-methylsulfanyl-N-(3-piperazin-1-ylpropyl)benzamide;hydrochloride |
| SMILES | CSc1ccc(C(=O)NCCCN2CCNCC2)cc1.Cl |
| InChI | InChI=1S/C15H23N3OS.ClH/c1-20-14-5-3-13(4-6-14)15(19)17-7-2-10-18-11-8-16-9-12-18;/h3-6,16H,2,7-12H2,1H3,(H,17,19);1H |
| InChIKey | VWCJHCQJMKNEQM-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 44.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.90 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|