C15H21ClF3N3O — CID 119391119
N-(3-piperazin-1-ylpropyl)-4-(trifluoromethyl)benzamide;hydrochloride (PubChem CID 119391119) has the molecular formula C15H21ClF3N3O and a molecular weight of 351.80 g/mol. Its IUPAC name is N-(3-piperazin-1-ylpropyl)-4-(trifluoromethyl)benzamide;hydrochloride.
| Compound Name | N-(3-piperazin-1-ylpropyl)-4-(trifluoromethyl)benzamide;hydrochloride |
|---|---|
| PubChem CID | 119391119 |
| Molecular Formula | C15H21ClF3N3O |
| Molecular Weight | 351.80 g/mol |
| Exact Mass | 351.13 |
| IUPAC Name | N-(3-piperazin-1-ylpropyl)-4-(trifluoromethyl)benzamide;hydrochloride |
| SMILES | Cl.O=C(NCCCN1CCNCC1)c1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C15H20F3N3O.ClH/c16-15(17,18)13-4-2-12(3-5-13)14(22)20-6-1-9-21-10-7-19-8-11-21;/h2-5,19H,1,6-11H2,(H,20,22);1H |
| InChIKey | SRLQJZYLOIGSGB-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 44.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.80 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|