C14H21Cl2F3N4O — CID 119393326
N-(3-piperazin-1-ylpropyl)-6-(trifluoromethyl)pyridine-3-carboxamide;dihydrochloride (PubChem CID 119393326) has the molecular formula C14H21Cl2F3N4O and a molecular weight of 389.25 g/mol. Its IUPAC name is N-(3-piperazin-1-ylpropyl)-6-(trifluoromethyl)pyridine-3-carboxamide;dihydrochloride.
| Compound Name | N-(3-piperazin-1-ylpropyl)-6-(trifluoromethyl)pyridine-3-carboxamide;dihydrochloride |
|---|---|
| PubChem CID | 119393326 |
| Molecular Formula | C14H21Cl2F3N4O |
| Molecular Weight | 389.25 g/mol |
| Exact Mass | 388.10 |
| IUPAC Name | N-(3-piperazin-1-ylpropyl)-6-(trifluoromethyl)pyridine-3-carboxamide;dihydrochloride |
| SMILES | Cl.Cl.O=C(NCCCN1CCNCC1)c1ccc(C(F)(F)F)nc1 |
| InChI | InChI=1S/C14H19F3N4O.2ClH/c15-14(16,17)12-3-2-11(10-20-12)13(22)19-4-1-7-21-8-5-18-6-9-21;;/h2-3,10,18H,1,4-9H2,(H,19,22);2*1H |
| InChIKey | ZEJJXFKIGKNJEY-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 57.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.25 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|