C15H23Cl2N5O — CID 119392015
N-(3-piperazin-1-ylpropyl)imidazo[1,2-a]pyridine-6-carboxamide;dihydrochloride (PubChem CID 119392015) has the molecular formula C15H23Cl2N5O and a molecular weight of 360.29 g/mol. Its IUPAC name is N-(3-piperazin-1-ylpropyl)imidazo[1,2-a]pyridine-6-carboxamide;dihydrochloride.
| Compound Name | N-(3-piperazin-1-ylpropyl)imidazo[1,2-a]pyridine-6-carboxamide;dihydrochloride |
|---|---|
| PubChem CID | 119392015 |
| Molecular Formula | C15H23Cl2N5O |
| Molecular Weight | 360.29 g/mol |
| Exact Mass | 359.13 |
| IUPAC Name | N-(3-piperazin-1-ylpropyl)imidazo[1,2-a]pyridine-6-carboxamide;dihydrochloride |
| SMILES | Cl.Cl.O=C(NCCCN1CCNCC1)c1ccc2nccn2c1 |
| InChI | InChI=1S/C15H21N5O.2ClH/c21-15(13-2-3-14-17-7-11-20(14)12-13)18-4-1-8-19-9-5-16-6-10-19;;/h2-3,7,11-12,16H,1,4-6,8-10H2,(H,18,21);2*1H |
| InChIKey | LKELEIMWNDHJCU-UHFFFAOYSA-N |
| XLogP | 1.20 |
| TPSA | 61.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.29 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|