C16H21N5O2 — CID 119393529
4-(1,2,4-oxadiazol-3-yl)-N-(3-piperazin-1-ylpropyl)benzamide (PubChem CID 119393529) has the molecular formula C16H21N5O2 and a molecular weight of 315.38 g/mol. Its IUPAC name is 4-(1,2,4-oxadiazol-3-yl)-N-(3-piperazin-1-ylpropyl)benzamide.
| Compound Name | 4-(1,2,4-oxadiazol-3-yl)-N-(3-piperazin-1-ylpropyl)benzamide |
|---|---|
| PubChem CID | 119393529 |
| Molecular Formula | C16H21N5O2 |
| Molecular Weight | 315.38 g/mol |
| Exact Mass | 315.17 |
| IUPAC Name | 4-(1,2,4-oxadiazol-3-yl)-N-(3-piperazin-1-ylpropyl)benzamide |
| SMILES | O=C(NCCCN1CCNCC1)c1ccc(-c2ncon2)cc1 |
| InChI | InChI=1S/C16H21N5O2/c22-16(18-6-1-9-21-10-7-17-8-11-21)14-4-2-13(3-5-14)15-19-12-23-20-15/h2-5,12,17H,1,6-11H2,(H,18,22) |
| InChIKey | MRNFGRWPBGIVLK-UHFFFAOYSA-N |
| XLogP | 0.76 |
| TPSA | 83.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.38 |
| LogP ≤ 5 | 0.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|