C18H27FN4O2 — CID 119391611
4-fluoro-N-[4-oxo-4-(3-piperazin-1-ylpropylamino)butyl]benzamide (PubChem CID 119391611) has the molecular formula C18H27FN4O2 and a molecular weight of 350.44 g/mol. Its IUPAC name is 4-fluoro-N-[4-oxo-4-(3-piperazin-1-ylpropylamino)butyl]benzamide.
| Compound Name | 4-fluoro-N-[4-oxo-4-(3-piperazin-1-ylpropylamino)butyl]benzamide |
|---|---|
| PubChem CID | 119391611 |
| Molecular Formula | C18H27FN4O2 |
| Molecular Weight | 350.44 g/mol |
| Exact Mass | 350.21 |
| IUPAC Name | 4-fluoro-N-[4-oxo-4-(3-piperazin-1-ylpropylamino)butyl]benzamide |
| SMILES | O=C(CCCNC(=O)c1ccc(F)cc1)NCCCN1CCNCC1 |
| InChI | InChI=1S/C18H27FN4O2/c19-16-6-4-15(5-7-16)18(25)22-8-1-3-17(24)21-9-2-12-23-13-10-20-11-14-23/h4-7,20H,1-3,8-14H2,(H,21,24)(H,22,25) |
| InChIKey | KCQZOVCVWUXCGW-UHFFFAOYSA-N |
| XLogP | 0.75 |
| TPSA | 73.47 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.44 |
| LogP ≤ 5 | 0.75 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|