C21H29ClN4O2 — CID 119393815
N-[3-oxo-3-(3-piperazin-1-ylpropylamino)propyl]naphthalene-2-carboxamide;hydrochloride (PubChem CID 119393815) has the molecular formula C21H29ClN4O2 and a molecular weight of 404.94 g/mol. Its IUPAC name is N-[3-oxo-3-(3-piperazin-1-ylpropylamino)propyl]naphthalene-2-carboxamide;hydrochloride.
| Compound Name | N-[3-oxo-3-(3-piperazin-1-ylpropylamino)propyl]naphthalene-2-carboxamide;hydrochloride |
|---|---|
| PubChem CID | 119393815 |
| Molecular Formula | C21H29ClN4O2 |
| Molecular Weight | 404.94 g/mol |
| Exact Mass | 404.20 |
| IUPAC Name | N-[3-oxo-3-(3-piperazin-1-ylpropylamino)propyl]naphthalene-2-carboxamide;hydrochloride |
| SMILES | Cl.O=C(CCNC(=O)c1ccc2ccccc2c1)NCCCN1CCNCC1 |
| InChI | InChI=1S/C21H28N4O2.ClH/c26-20(23-9-3-13-25-14-11-22-12-15-25)8-10-24-21(27)19-7-6-17-4-1-2-5-18(17)16-19;/h1-2,4-7,16,22H,3,8-15H2,(H,23,26)(H,24,27);1H |
| InChIKey | BSDBWWLTQXJAGJ-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 73.47 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.94 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|