C15H24N4O3 — CID 119391210
N-[3-oxo-3-(3-piperazin-1-ylpropylamino)propyl]furan-2-carboxamide (PubChem CID 119391210) has the molecular formula C15H24N4O3 and a molecular weight of 308.38 g/mol. Its IUPAC name is N-[3-oxo-3-(3-piperazin-1-ylpropylamino)propyl]furan-2-carboxamide.
| Compound Name | N-[3-oxo-3-(3-piperazin-1-ylpropylamino)propyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 119391210 |
| Molecular Formula | C15H24N4O3 |
| Molecular Weight | 308.38 g/mol |
| Exact Mass | 308.18 |
| IUPAC Name | N-[3-oxo-3-(3-piperazin-1-ylpropylamino)propyl]furan-2-carboxamide |
| SMILES | O=C(CCNC(=O)c1ccco1)NCCCN1CCNCC1 |
| InChI | InChI=1S/C15H24N4O3/c20-14(4-6-18-15(21)13-3-1-12-22-13)17-5-2-9-19-10-7-16-8-11-19/h1,3,12,16H,2,4-11H2,(H,17,20)(H,18,21) |
| InChIKey | JCLBPHVAFRZILM-UHFFFAOYSA-N |
| XLogP | -0.19 |
| TPSA | 86.61 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.38 |
| LogP ≤ 5 | -0.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|