C20H27ClN4O4 — CID 119392955
N-[3-[2-oxo-2-(3-piperazin-1-ylpropylamino)ethoxy]phenyl]furan-2-carboxamide;hydrochloride (PubChem CID 119392955) has the molecular formula C20H27ClN4O4 and a molecular weight of 422.91 g/mol. Its IUPAC name is N-[3-[2-oxo-2-(3-piperazin-1-ylpropylamino)ethoxy]phenyl]furan-2-carboxamide;hydrochloride.
| Compound Name | N-[3-[2-oxo-2-(3-piperazin-1-ylpropylamino)ethoxy]phenyl]furan-2-carboxamide;hydrochloride |
|---|---|
| PubChem CID | 119392955 |
| Molecular Formula | C20H27ClN4O4 |
| Molecular Weight | 422.91 g/mol |
| Exact Mass | 422.17 |
| IUPAC Name | N-[3-[2-oxo-2-(3-piperazin-1-ylpropylamino)ethoxy]phenyl]furan-2-carboxamide;hydrochloride |
| SMILES | Cl.O=C(COc1cccc(NC(=O)c2ccco2)c1)NCCCN1CCNCC1 |
| InChI | InChI=1S/C20H26N4O4.ClH/c25-19(22-7-3-10-24-11-8-21-9-12-24)15-28-17-5-1-4-16(14-17)23-20(26)18-6-2-13-27-18;/h1-2,4-6,13-14,21H,3,7-12,15H2,(H,22,25)(H,23,26);1H |
| InChIKey | DXUMAFUYGPPSMW-UHFFFAOYSA-N |
| XLogP | 1.74 |
| TPSA | 95.84 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.91 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|