C16H18N2O5 — CID 46547454
N-[3-[2-(2-methoxyethylamino)-2-oxoethoxy]phenyl]furan-2-carboxamide (PubChem CID 46547454) has the molecular formula C16H18N2O5 and a molecular weight of 318.33 g/mol. Its IUPAC name is N-[3-[2-(2-methoxyethylamino)-2-oxoethoxy]phenyl]furan-2-carboxamide.
| Compound Name | N-[3-[2-(2-methoxyethylamino)-2-oxoethoxy]phenyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 46547454 |
| Molecular Formula | C16H18N2O5 |
| Molecular Weight | 318.33 g/mol |
| Exact Mass | 318.12 |
| IUPAC Name | N-[3-[2-(2-methoxyethylamino)-2-oxoethoxy]phenyl]furan-2-carboxamide |
| SMILES | COCCNC(=O)COc1cccc(NC(=O)c2ccco2)c1 |
| InChI | InChI=1S/C16H18N2O5/c1-21-9-7-17-15(19)11-23-13-5-2-4-12(10-13)18-16(20)14-6-3-8-22-14/h2-6,8,10H,7,9,11H2,1H3,(H,17,19)(H,18,20) |
| InChIKey | UERMZFAESDHFAN-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 89.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.33 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|