C25H26N2O6 — CID 55620462
N-[3-[2-[2-[(2,2-dimethyl-3H-1-benzofuran-7-yl)oxy]ethylamino]-2-oxoethoxy]phenyl]furan-2-carboxamide (PubChem CID 55620462) has the molecular formula C25H26N2O6 and a molecular weight of 450.49 g/mol. Its IUPAC name is N-[3-[2-[2-[(2,2-dimethyl-3H-1-benzofuran-7-yl)oxy]ethylamino]-2-oxoethoxy]phenyl]furan-2-carboxamide.
| Compound Name | N-[3-[2-[2-[(2,2-dimethyl-3H-1-benzofuran-7-yl)oxy]ethylamino]-2-oxoethoxy]phenyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 55620462 |
| Molecular Formula | C25H26N2O6 |
| Molecular Weight | 450.49 g/mol |
| Exact Mass | 450.18 |
| IUPAC Name | N-[3-[2-[2-[(2,2-dimethyl-3H-1-benzofuran-7-yl)oxy]ethylamino]-2-oxoethoxy]phenyl]furan-2-carboxamide |
| SMILES | CC1(C)Cc2cccc(OCCNC(=O)COc3cccc(NC(=O)c4ccco4)c3)c2O1 |
| InChI | InChI=1S/C25H26N2O6/c1-25(2)15-17-6-3-9-20(23(17)33-25)31-13-11-26-22(28)16-32-19-8-4-7-18(14-19)27-24(29)21-10-5-12-30-21/h3-10,12,14H,11,13,15-16H2,1-2H3,(H,26,28)(H,27,29) |
| InChIKey | PPMBUOMDWMFYLM-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 99.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.49 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|