C21H22N2O6 — CID 86930220
N-[3-[2-[3-(furan-2-ylmethoxy)propylamino]-2-oxoethoxy]phenyl]furan-2-carboxamide (PubChem CID 86930220) has the molecular formula C21H22N2O6 and a molecular weight of 398.42 g/mol. Its IUPAC name is N-[3-[2-[3-(furan-2-ylmethoxy)propylamino]-2-oxoethoxy]phenyl]furan-2-carboxamide.
| Compound Name | N-[3-[2-[3-(furan-2-ylmethoxy)propylamino]-2-oxoethoxy]phenyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 86930220 |
| Molecular Formula | C21H22N2O6 |
| Molecular Weight | 398.42 g/mol |
| Exact Mass | 398.15 |
| IUPAC Name | N-[3-[2-[3-(furan-2-ylmethoxy)propylamino]-2-oxoethoxy]phenyl]furan-2-carboxamide |
| SMILES | O=C(COc1cccc(NC(=O)c2ccco2)c1)NCCCOCc1ccco1 |
| InChI | InChI=1S/C21H22N2O6/c24-20(22-9-4-10-26-14-18-7-2-11-27-18)15-29-17-6-1-5-16(13-17)23-21(25)19-8-3-12-28-19/h1-3,5-8,11-13H,4,9-10,14-15H2,(H,22,24)(H,23,25) |
| InChIKey | ISTCHLUZPWKBCH-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 102.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.42 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|