C20H19BrN2O5 — CID 55794211
5-bromo-N-[3-[3-(furan-2-ylmethoxy)propylcarbamoyl]phenyl]furan-2-carboxamide (PubChem CID 55794211) has the molecular formula C20H19BrN2O5 and a molecular weight of 447.29 g/mol. Its IUPAC name is 5-bromo-N-[3-[3-(furan-2-ylmethoxy)propylcarbamoyl]phenyl]furan-2-carboxamide.
| Compound Name | 5-bromo-N-[3-[3-(furan-2-ylmethoxy)propylcarbamoyl]phenyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 55794211 |
| Molecular Formula | C20H19BrN2O5 |
| Molecular Weight | 447.29 g/mol |
| Exact Mass | 446.05 |
| IUPAC Name | 5-bromo-N-[3-[3-(furan-2-ylmethoxy)propylcarbamoyl]phenyl]furan-2-carboxamide |
| SMILES | O=C(NCCCOCc1ccco1)c1cccc(NC(=O)c2ccc(Br)o2)c1 |
| InChI | InChI=1S/C20H19BrN2O5/c21-18-8-7-17(28-18)20(25)23-15-5-1-4-14(12-15)19(24)22-9-3-10-26-13-16-6-2-11-27-16/h1-2,4-8,11-12H,3,9-10,13H2,(H,22,24)(H,23,25) |
| InChIKey | UYOGITOBRHYJCH-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 93.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.29 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|