C16H11BrN2O4 — CID 1365371
5-bromo-N-[3-(furan-2-carbonylamino)phenyl]furan-2-carboxamide (PubChem CID 1365371) has the molecular formula C16H11BrN2O4 and a molecular weight of 375.18 g/mol. Its IUPAC name is 5-bromo-N-[3-(furan-2-carbonylamino)phenyl]furan-2-carboxamide.
| Compound Name | 5-bromo-N-[3-(furan-2-carbonylamino)phenyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 1365371 |
| Molecular Formula | C16H11BrN2O4 |
| Molecular Weight | 375.18 g/mol |
| Exact Mass | 373.99 |
| IUPAC Name | 5-bromo-N-[3-(furan-2-carbonylamino)phenyl]furan-2-carboxamide |
| SMILES | O=C(Nc1cccc(NC(=O)c2ccc(Br)o2)c1)c1ccco1 |
| InChI | InChI=1S/C16H11BrN2O4/c17-14-7-6-13(23-14)16(21)19-11-4-1-3-10(9-11)18-15(20)12-5-2-8-22-12/h1-9H,(H,18,20)(H,19,21) |
| InChIKey | UCHUUJCDHKWLNS-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 84.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.18 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |