C20H13BrN2O4 — CID 38938788
7-bromo-N-[3-(furan-2-carbonylamino)phenyl]-1-benzofuran-2-carboxamide (PubChem CID 38938788) has the molecular formula C20H13BrN2O4 and a molecular weight of 425.24 g/mol. Its IUPAC name is 7-bromo-N-[3-(furan-2-carbonylamino)phenyl]-1-benzofuran-2-carboxamide.
| Compound Name | 7-bromo-N-[3-(furan-2-carbonylamino)phenyl]-1-benzofuran-2-carboxamide |
|---|---|
| PubChem CID | 38938788 |
| Molecular Formula | C20H13BrN2O4 |
| Molecular Weight | 425.24 g/mol |
| Exact Mass | 424.01 |
| IUPAC Name | 7-bromo-N-[3-(furan-2-carbonylamino)phenyl]-1-benzofuran-2-carboxamide |
| SMILES | O=C(Nc1cccc(NC(=O)c2cc3cccc(Br)c3o2)c1)c1ccco1 |
| InChI | InChI=1S/C20H13BrN2O4/c21-15-7-1-4-12-10-17(27-18(12)15)20(25)23-14-6-2-5-13(11-14)22-19(24)16-8-3-9-26-16/h1-11H,(H,22,24)(H,23,25) |
| InChIKey | NPCSVRSOQTZHKE-UHFFFAOYSA-N |
| XLogP | 5.29 |
| TPSA | 84.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.24 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |