C17H14BrNO2 — CID 38885789
7-bromo-N-(2,3-dimethylphenyl)-1-benzofuran-2-carboxamide (PubChem CID 38885789) has the molecular formula C17H14BrNO2 and a molecular weight of 344.21 g/mol. Its IUPAC name is 7-bromo-N-(2,3-dimethylphenyl)-1-benzofuran-2-carboxamide.
| Compound Name | 7-bromo-N-(2,3-dimethylphenyl)-1-benzofuran-2-carboxamide |
|---|---|
| PubChem CID | 38885789 |
| Molecular Formula | C17H14BrNO2 |
| Molecular Weight | 344.21 g/mol |
| Exact Mass | 343.02 |
| IUPAC Name | 7-bromo-N-(2,3-dimethylphenyl)-1-benzofuran-2-carboxamide |
| SMILES | Cc1cccc(NC(=O)c2cc3cccc(Br)c3o2)c1C |
| InChI | InChI=1S/C17H14BrNO2/c1-10-5-3-8-14(11(10)2)19-17(20)15-9-12-6-4-7-13(18)16(12)21-15/h3-9H,1-2H3,(H,19,20) |
| InChIKey | KGNAIECQVXGEQN-UHFFFAOYSA-N |
| XLogP | 5.06 |
| TPSA | 42.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.21 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |