C18H14BrNO4 — CID 38908619
methyl 3-[(7-bromo-1-benzofuran-2-carbonyl)amino]-4-methylbenzoate (PubChem CID 38908619) has the molecular formula C18H14BrNO4 and a molecular weight of 388.22 g/mol. Its IUPAC name is methyl 3-[(7-bromo-1-benzofuran-2-carbonyl)amino]-4-methylbenzoate.
| Compound Name | methyl 3-[(7-bromo-1-benzofuran-2-carbonyl)amino]-4-methylbenzoate |
|---|---|
| PubChem CID | 38908619 |
| Molecular Formula | C18H14BrNO4 |
| Molecular Weight | 388.22 g/mol |
| Exact Mass | 387.01 |
| IUPAC Name | methyl 3-[(7-bromo-1-benzofuran-2-carbonyl)amino]-4-methylbenzoate |
| SMILES | COC(=O)c1ccc(C)c(NC(=O)c2cc3cccc(Br)c3o2)c1 |
| InChI | InChI=1S/C18H14BrNO4/c1-10-6-7-12(18(22)23-2)8-14(10)20-17(21)15-9-11-4-3-5-13(19)16(11)24-15/h3-9H,1-2H3,(H,20,21) |
| InChIKey | CNYRRPJHPATFHC-UHFFFAOYSA-N |
| XLogP | 4.54 |
| TPSA | 68.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.22 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |