C15H10BrNO4S — CID 38928922
methyl 3-[(7-bromo-1-benzofuran-2-carbonyl)amino]thiophene-2-carboxylate (PubChem CID 38928922) has the molecular formula C15H10BrNO4S and a molecular weight of 380.22 g/mol. Its IUPAC name is methyl 3-[(7-bromo-1-benzofuran-2-carbonyl)amino]thiophene-2-carboxylate.
| Compound Name | methyl 3-[(7-bromo-1-benzofuran-2-carbonyl)amino]thiophene-2-carboxylate |
|---|---|
| PubChem CID | 38928922 |
| Molecular Formula | C15H10BrNO4S |
| Molecular Weight | 380.22 g/mol |
| Exact Mass | 378.95 |
| IUPAC Name | methyl 3-[(7-bromo-1-benzofuran-2-carbonyl)amino]thiophene-2-carboxylate |
| SMILES | COC(=O)c1sccc1NC(=O)c1cc2cccc(Br)c2o1 |
| InChI | InChI=1S/C15H10BrNO4S/c1-20-15(19)13-10(5-6-22-13)17-14(18)11-7-8-3-2-4-9(16)12(8)21-11/h2-7H,1H3,(H,17,18) |
| InChIKey | ZSUHLXYUFNCZAM-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 68.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.22 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |