C21H19BrN2O5 — CID 46450917
methyl 2-[(7-bromo-1-benzofuran-2-carbonyl)amino]-5-morpholin-4-ylbenzoate (PubChem CID 46450917) has the molecular formula C21H19BrN2O5 and a molecular weight of 459.30 g/mol. Its IUPAC name is methyl 2-[(7-bromo-1-benzofuran-2-carbonyl)amino]-5-morpholin-4-ylbenzoate.
| Compound Name | methyl 2-[(7-bromo-1-benzofuran-2-carbonyl)amino]-5-morpholin-4-ylbenzoate |
|---|---|
| PubChem CID | 46450917 |
| Molecular Formula | C21H19BrN2O5 |
| Molecular Weight | 459.30 g/mol |
| Exact Mass | 458.05 |
| IUPAC Name | methyl 2-[(7-bromo-1-benzofuran-2-carbonyl)amino]-5-morpholin-4-ylbenzoate |
| SMILES | COC(=O)c1cc(N2CCOCC2)ccc1NC(=O)c1cc2cccc(Br)c2o1 |
| InChI | InChI=1S/C21H19BrN2O5/c1-27-21(26)15-12-14(24-7-9-28-10-8-24)5-6-17(15)23-20(25)18-11-13-3-2-4-16(22)19(13)29-18/h2-6,11-12H,7-10H2,1H3,(H,23,25) |
| InChIKey | GPGJYLIIFXEVIT-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 81.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.30 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |