C15H23Cl2N3O4 — CID 119840940
methyl 2-[[2-(methylamino)acetyl]amino]-5-morpholin-4-ylbenzoate;dihydrochloride (PubChem CID 119840940) has the molecular formula C15H23Cl2N3O4 and a molecular weight of 380.27 g/mol. Its IUPAC name is methyl 2-[[2-(methylamino)acetyl]amino]-5-morpholin-4-ylbenzoate;dihydrochloride.
| Compound Name | methyl 2-[[2-(methylamino)acetyl]amino]-5-morpholin-4-ylbenzoate;dihydrochloride |
|---|---|
| PubChem CID | 119840940 |
| Molecular Formula | C15H23Cl2N3O4 |
| Molecular Weight | 380.27 g/mol |
| Exact Mass | 379.11 |
| IUPAC Name | methyl 2-[[2-(methylamino)acetyl]amino]-5-morpholin-4-ylbenzoate;dihydrochloride |
| SMILES | CNCC(=O)Nc1ccc(N2CCOCC2)cc1C(=O)OC.Cl.Cl |
| InChI | InChI=1S/C15H21N3O4.2ClH/c1-16-10-14(19)17-13-4-3-11(9-12(13)15(20)21-2)18-5-7-22-8-6-18;;/h3-4,9,16H,5-8,10H2,1-2H3,(H,17,19);2*1H |
| InChIKey | QMEZVJSIGQJQTG-UHFFFAOYSA-N |
| XLogP | 1.31 |
| TPSA | 79.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.27 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |