C16H25Cl2N3O4 — CID 119840954
methyl 2-[[(2S)-2-aminobutanoyl]amino]-5-morpholin-4-ylbenzoate;dihydrochloride (PubChem CID 119840954) has the molecular formula C16H25Cl2N3O4 and a molecular weight of 394.30 g/mol. Its IUPAC name is methyl 2-[[(2S)-2-aminobutanoyl]amino]-5-morpholin-4-ylbenzoate;dihydrochloride.
| Compound Name | methyl 2-[[(2S)-2-aminobutanoyl]amino]-5-morpholin-4-ylbenzoate;dihydrochloride |
|---|---|
| PubChem CID | 119840954 |
| Molecular Formula | C16H25Cl2N3O4 |
| Molecular Weight | 394.30 g/mol |
| Exact Mass | 393.12 |
| IUPAC Name | methyl 2-[[(2S)-2-aminobutanoyl]amino]-5-morpholin-4-ylbenzoate;dihydrochloride |
| SMILES | CC[C@H](N)C(=O)Nc1ccc(N2CCOCC2)cc1C(=O)OC.Cl.Cl |
| InChI | InChI=1S/C16H23N3O4.2ClH/c1-3-13(17)15(20)18-14-5-4-11(10-12(14)16(21)22-2)19-6-8-23-9-7-19;;/h4-5,10,13H,3,6-9,17H2,1-2H3,(H,18,20);2*1H/t13-;;/m0../s1 |
| InChIKey | BPCKXMUMBOQQRB-GXKRWWSZSA-N |
| XLogP | 1.83 |
| TPSA | 93.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.30 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |