C18H21N3O7S — CID 56523449
methyl 2-[[5-(methylsulfamoyl)furan-2-carbonyl]amino]-5-morpholin-4-ylbenzoate (PubChem CID 56523449) has the molecular formula C18H21N3O7S and a molecular weight of 423.45 g/mol. Its IUPAC name is methyl 2-[[5-(methylsulfamoyl)furan-2-carbonyl]amino]-5-morpholin-4-ylbenzoate.
| Compound Name | methyl 2-[[5-(methylsulfamoyl)furan-2-carbonyl]amino]-5-morpholin-4-ylbenzoate |
|---|---|
| PubChem CID | 56523449 |
| Molecular Formula | C18H21N3O7S |
| Molecular Weight | 423.45 g/mol |
| Exact Mass | 423.11 |
| IUPAC Name | methyl 2-[[5-(methylsulfamoyl)furan-2-carbonyl]amino]-5-morpholin-4-ylbenzoate |
| SMILES | CNS(=O)(=O)c1ccc(C(=O)Nc2ccc(N3CCOCC3)cc2C(=O)OC)o1 |
| InChI | InChI=1S/C18H21N3O7S/c1-19-29(24,25)16-6-5-15(28-16)17(22)20-14-4-3-12(11-13(14)18(23)26-2)21-7-9-27-10-8-21/h3-6,11,19H,7-10H2,1-2H3,(H,20,22) |
| InChIKey | UIZFIEQFYIQGIG-UHFFFAOYSA-N |
| XLogP | 1.06 |
| TPSA | 127.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.45 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |