C13H14N2O5S — CID 84577321
N-(4-hydroxy-2-methylphenyl)-5-(methylsulfamoyl)furan-2-carboxamide (PubChem CID 84577321) has the molecular formula C13H14N2O5S and a molecular weight of 310.33 g/mol. Its IUPAC name is N-(4-hydroxy-2-methylphenyl)-5-(methylsulfamoyl)furan-2-carboxamide.
| Compound Name | N-(4-hydroxy-2-methylphenyl)-5-(methylsulfamoyl)furan-2-carboxamide |
|---|---|
| PubChem CID | 84577321 |
| Molecular Formula | C13H14N2O5S |
| Molecular Weight | 310.33 g/mol |
| Exact Mass | 310.06 |
| IUPAC Name | N-(4-hydroxy-2-methylphenyl)-5-(methylsulfamoyl)furan-2-carboxamide |
| SMILES | CNS(=O)(=O)c1ccc(C(=O)Nc2ccc(O)cc2C)o1 |
| InChI | InChI=1S/C13H14N2O5S/c1-8-7-9(16)3-4-10(8)15-13(17)11-5-6-12(20-11)21(18,19)14-2/h3-7,14,16H,1-2H3,(H,15,17) |
| InChIKey | MMDWNJSCLPRFPA-UHFFFAOYSA-N |
| XLogP | 1.45 |
| TPSA | 108.64 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.33 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|