C14H13ClN2O3 — CID 110699924
5-acetamido-N-(4-chloro-2-methylphenyl)furan-2-carboxamide (PubChem CID 110699924) has the molecular formula C14H13ClN2O3 and a molecular weight of 292.72 g/mol. Its IUPAC name is 5-acetamido-N-(4-chloro-2-methylphenyl)furan-2-carboxamide.
| Compound Name | 5-acetamido-N-(4-chloro-2-methylphenyl)furan-2-carboxamide |
|---|---|
| PubChem CID | 110699924 |
| Molecular Formula | C14H13ClN2O3 |
| Molecular Weight | 292.72 g/mol |
| Exact Mass | 292.06 |
| IUPAC Name | 5-acetamido-N-(4-chloro-2-methylphenyl)furan-2-carboxamide |
| SMILES | CC(=O)Nc1ccc(C(=O)Nc2ccc(Cl)cc2C)o1 |
| InChI | InChI=1S/C14H13ClN2O3/c1-8-7-10(15)3-4-11(8)17-14(19)12-5-6-13(20-12)16-9(2)18/h3-7H,1-2H3,(H,16,18)(H,17,19) |
| InChIKey | PTRHTVJRJRWWEY-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 71.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.72 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |