C13H10Cl2N2O3 — CID 110699992
5-acetamido-N-(3,4-dichlorophenyl)furan-2-carboxamide (PubChem CID 110699992) has the molecular formula C13H10Cl2N2O3 and a molecular weight of 313.14 g/mol. Its IUPAC name is 5-acetamido-N-(3,4-dichlorophenyl)furan-2-carboxamide.
| Compound Name | 5-acetamido-N-(3,4-dichlorophenyl)furan-2-carboxamide |
|---|---|
| PubChem CID | 110699992 |
| Molecular Formula | C13H10Cl2N2O3 |
| Molecular Weight | 313.14 g/mol |
| Exact Mass | 312.01 |
| IUPAC Name | 5-acetamido-N-(3,4-dichlorophenyl)furan-2-carboxamide |
| SMILES | CC(=O)Nc1ccc(C(=O)Nc2ccc(Cl)c(Cl)c2)o1 |
| InChI | InChI=1S/C13H10Cl2N2O3/c1-7(18)16-12-5-4-11(20-12)13(19)17-8-2-3-9(14)10(15)6-8/h2-6H,1H3,(H,16,18)(H,17,19) |
| InChIKey | XBDFEAFZIGHVGL-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 71.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.14 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |