C17H15Cl2N3O3 — CID 2524728
3,5-diacetamido-N-(3,4-dichlorophenyl)benzamide (PubChem CID 2524728) has the molecular formula C17H15Cl2N3O3 and a molecular weight of 380.23 g/mol. Its IUPAC name is 3,5-diacetamido-N-(3,4-dichlorophenyl)benzamide.
| Compound Name | 3,5-diacetamido-N-(3,4-dichlorophenyl)benzamide |
|---|---|
| PubChem CID | 2524728 |
| Molecular Formula | C17H15Cl2N3O3 |
| Molecular Weight | 380.23 g/mol |
| Exact Mass | 379.05 |
| IUPAC Name | 3,5-diacetamido-N-(3,4-dichlorophenyl)benzamide |
| SMILES | CC(=O)Nc1cc(NC(C)=O)cc(C(=O)Nc2ccc(Cl)c(Cl)c2)c1 |
| InChI | InChI=1S/C17H15Cl2N3O3/c1-9(23)20-13-5-11(6-14(7-13)21-10(2)24)17(25)22-12-3-4-15(18)16(19)8-12/h3-8H,1-2H3,(H,20,23)(H,21,24)(H,22,25) |
| InChIKey | AVRCFITUKYHOFY-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 87.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.23 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |