C14H11Cl2N3O2 — CID 29201519
3-(carbamoylamino)-N-(3,4-dichlorophenyl)benzamide (PubChem CID 29201519) has the molecular formula C14H11Cl2N3O2 and a molecular weight of 324.17 g/mol. Its IUPAC name is 3-(carbamoylamino)-N-(3,4-dichlorophenyl)benzamide.
| Compound Name | 3-(carbamoylamino)-N-(3,4-dichlorophenyl)benzamide |
|---|---|
| PubChem CID | 29201519 |
| Molecular Formula | C14H11Cl2N3O2 |
| Molecular Weight | 324.17 g/mol |
| Exact Mass | 323.02 |
| IUPAC Name | 3-(carbamoylamino)-N-(3,4-dichlorophenyl)benzamide |
| SMILES | NC(=O)Nc1cccc(C(=O)Nc2ccc(Cl)c(Cl)c2)c1 |
| InChI | InChI=1S/C14H11Cl2N3O2/c15-11-5-4-10(7-12(11)16)18-13(20)8-2-1-3-9(6-8)19-14(17)21/h1-7H,(H,18,20)(H3,17,19,21) |
| InChIKey | FVFCQXFGWVOKBT-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 84.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.17 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |