C16H18N4O2 — CID 78776448
3-(carbamoylamino)-N-[4-(dimethylamino)phenyl]benzamide (PubChem CID 78776448) has the molecular formula C16H18N4O2 and a molecular weight of 298.35 g/mol. Its IUPAC name is 3-(carbamoylamino)-N-[4-(dimethylamino)phenyl]benzamide.
| Compound Name | 3-(carbamoylamino)-N-[4-(dimethylamino)phenyl]benzamide |
|---|---|
| PubChem CID | 78776448 |
| Molecular Formula | C16H18N4O2 |
| Molecular Weight | 298.35 g/mol |
| Exact Mass | 298.14 |
| IUPAC Name | 3-(carbamoylamino)-N-[4-(dimethylamino)phenyl]benzamide |
| SMILES | CN(C)c1ccc(NC(=O)c2cccc(NC(N)=O)c2)cc1 |
| InChI | InChI=1S/C16H18N4O2/c1-20(2)14-8-6-12(7-9-14)18-15(21)11-4-3-5-13(10-11)19-16(17)22/h3-10H,1-2H3,(H,18,21)(H3,17,19,22) |
| InChIKey | ZFUIFZOMMAJYNY-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 87.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.35 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|