C17H21N3O3S — CID 110356126
N-[4-(dimethylamino)phenyl]-3-(dimethylsulfamoyl)benzamide (PubChem CID 110356126) has the molecular formula C17H21N3O3S and a molecular weight of 347.44 g/mol. Its IUPAC name is N-[4-(dimethylamino)phenyl]-3-(dimethylsulfamoyl)benzamide.
| Compound Name | N-[4-(dimethylamino)phenyl]-3-(dimethylsulfamoyl)benzamide |
|---|---|
| PubChem CID | 110356126 |
| Molecular Formula | C17H21N3O3S |
| Molecular Weight | 347.44 g/mol |
| Exact Mass | 347.13 |
| IUPAC Name | N-[4-(dimethylamino)phenyl]-3-(dimethylsulfamoyl)benzamide |
| SMILES | CN(C)c1ccc(NC(=O)c2cccc(S(=O)(=O)N(C)C)c2)cc1 |
| InChI | InChI=1S/C17H21N3O3S/c1-19(2)15-10-8-14(9-11-15)18-17(21)13-6-5-7-16(12-13)24(22,23)20(3)4/h5-12H,1-4H3,(H,18,21) |
| InChIKey | GPKZKFISWIPSJH-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.44 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|