C22H19N3O5S2 — CID 90342533
N-(4-cyanophenyl)-3-[methyl-(4-methylsulfonylphenyl)sulfamoyl]benzamide (PubChem CID 90342533) has the molecular formula C22H19N3O5S2 and a molecular weight of 469.54 g/mol. Its IUPAC name is N-(4-cyanophenyl)-3-[methyl-(4-methylsulfonylphenyl)sulfamoyl]benzamide.
| Compound Name | N-(4-cyanophenyl)-3-[methyl-(4-methylsulfonylphenyl)sulfamoyl]benzamide |
|---|---|
| PubChem CID | 90342533 |
| Molecular Formula | C22H19N3O5S2 |
| Molecular Weight | 469.54 g/mol |
| Exact Mass | 469.08 |
| IUPAC Name | N-(4-cyanophenyl)-3-[methyl-(4-methylsulfonylphenyl)sulfamoyl]benzamide |
| SMILES | CN(c1ccc(S(C)(=O)=O)cc1)S(=O)(=O)c1cccc(C(=O)Nc2ccc(C#N)cc2)c1 |
| InChI | InChI=1S/C22H19N3O5S2/c1-25(19-10-12-20(13-11-19)31(2,27)28)32(29,30)21-5-3-4-17(14-21)22(26)24-18-8-6-16(15-23)7-9-18/h3-14H,1-2H3,(H,24,26) |
| InChIKey | QTQATTXAHSSCCI-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 124.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.54 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |