C26H29N3O4S — CID 100625475
N-[3-[(4-tert-butylbenzoyl)amino]phenyl]-3-(dimethylsulfamoyl)benzamide (PubChem CID 100625475) has the molecular formula C26H29N3O4S and a molecular weight of 479.60 g/mol. Its IUPAC name is N-[3-[(4-tert-butylbenzoyl)amino]phenyl]-3-(dimethylsulfamoyl)benzamide.
| Compound Name | N-[3-[(4-tert-butylbenzoyl)amino]phenyl]-3-(dimethylsulfamoyl)benzamide |
|---|---|
| PubChem CID | 100625475 |
| Molecular Formula | C26H29N3O4S |
| Molecular Weight | 479.60 g/mol |
| Exact Mass | 479.19 |
| IUPAC Name | N-[3-[(4-tert-butylbenzoyl)amino]phenyl]-3-(dimethylsulfamoyl)benzamide |
| SMILES | CN(C)S(=O)(=O)c1cccc(C(=O)Nc2cccc(NC(=O)c3ccc(C(C)(C)C)cc3)c2)c1 |
| InChI | InChI=1S/C26H29N3O4S/c1-26(2,3)20-14-12-18(13-15-20)24(30)27-21-9-7-10-22(17-21)28-25(31)19-8-6-11-23(16-19)34(32,33)29(4)5/h6-17H,1-5H3,(H,27,30)(H,28,31) |
| InChIKey | AIBFVCRMAXLGLZ-UHFFFAOYSA-N |
| XLogP | 4.74 |
| TPSA | 95.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.60 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |