C25H26N2O4S — CID 100621284
N-[3-(4-tert-butylbenzoyl)phenyl]-3-(methylsulfamoyl)benzamide (PubChem CID 100621284) has the molecular formula C25H26N2O4S and a molecular weight of 450.56 g/mol. Its IUPAC name is N-[3-(4-tert-butylbenzoyl)phenyl]-3-(methylsulfamoyl)benzamide.
| Compound Name | N-[3-(4-tert-butylbenzoyl)phenyl]-3-(methylsulfamoyl)benzamide |
|---|---|
| PubChem CID | 100621284 |
| Molecular Formula | C25H26N2O4S |
| Molecular Weight | 450.56 g/mol |
| Exact Mass | 450.16 |
| IUPAC Name | N-[3-(4-tert-butylbenzoyl)phenyl]-3-(methylsulfamoyl)benzamide |
| SMILES | CNS(=O)(=O)c1cccc(C(=O)Nc2cccc(C(=O)c3ccc(C(C)(C)C)cc3)c2)c1 |
| InChI | InChI=1S/C25H26N2O4S/c1-25(2,3)20-13-11-17(12-14-20)23(28)18-7-5-9-21(15-18)27-24(29)19-8-6-10-22(16-19)32(30,31)26-4/h5-16,26H,1-4H3,(H,27,29) |
| InChIKey | BPSKPMUASLUUGK-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 92.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.56 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |