C20H26N2O3S — CID 133231293
N-[1-(4-tert-butylphenyl)ethyl]-3-(methylsulfamoyl)benzamide (PubChem CID 133231293) has the molecular formula C20H26N2O3S and a molecular weight of 374.51 g/mol. Its IUPAC name is N-[1-(4-tert-butylphenyl)ethyl]-3-(methylsulfamoyl)benzamide.
| Compound Name | N-[1-(4-tert-butylphenyl)ethyl]-3-(methylsulfamoyl)benzamide |
|---|---|
| PubChem CID | 133231293 |
| Molecular Formula | C20H26N2O3S |
| Molecular Weight | 374.51 g/mol |
| Exact Mass | 374.17 |
| IUPAC Name | N-[1-(4-tert-butylphenyl)ethyl]-3-(methylsulfamoyl)benzamide |
| SMILES | CNS(=O)(=O)c1cccc(C(=O)NC(C)c2ccc(C(C)(C)C)cc2)c1 |
| InChI | InChI=1S/C20H26N2O3S/c1-14(15-9-11-17(12-10-15)20(2,3)4)22-19(23)16-7-6-8-18(13-16)26(24,25)21-5/h6-14,21H,1-5H3,(H,22,23) |
| InChIKey | HZWNKNNRKMBBSM-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.51 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |