C19H17F3N2O3S — CID 43062333
3-(prop-2-ynylsulfamoyl)-N-[1-[4-(trifluoromethyl)phenyl]ethyl]benzamide (PubChem CID 43062333) has the molecular formula C19H17F3N2O3S and a molecular weight of 410.42 g/mol. Its IUPAC name is 3-(prop-2-ynylsulfamoyl)-N-[1-[4-(trifluoromethyl)phenyl]ethyl]benzamide.
| Compound Name | 3-(prop-2-ynylsulfamoyl)-N-[1-[4-(trifluoromethyl)phenyl]ethyl]benzamide |
|---|---|
| PubChem CID | 43062333 |
| Molecular Formula | C19H17F3N2O3S |
| Molecular Weight | 410.42 g/mol |
| Exact Mass | 410.09 |
| IUPAC Name | 3-(prop-2-ynylsulfamoyl)-N-[1-[4-(trifluoromethyl)phenyl]ethyl]benzamide |
| SMILES | C#CCNS(=O)(=O)c1cccc(C(=O)NC(C)c2ccc(C(F)(F)F)cc2)c1 |
| InChI | InChI=1S/C19H17F3N2O3S/c1-3-11-23-28(26,27)17-6-4-5-15(12-17)18(25)24-13(2)14-7-9-16(10-8-14)19(20,21)22/h1,4-10,12-13,23H,11H2,2H3,(H,24,25) |
| InChIKey | XVGATRRFEQPXBX-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.42 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|