C24H22N2O3S — CID 27018001
N-(2,2-diphenylethyl)-3-(prop-2-ynylsulfamoyl)benzamide (PubChem CID 27018001) has the molecular formula C24H22N2O3S and a molecular weight of 418.52 g/mol. Its IUPAC name is N-(2,2-diphenylethyl)-3-(prop-2-ynylsulfamoyl)benzamide.
| Compound Name | N-(2,2-diphenylethyl)-3-(prop-2-ynylsulfamoyl)benzamide |
|---|---|
| PubChem CID | 27018001 |
| Molecular Formula | C24H22N2O3S |
| Molecular Weight | 418.52 g/mol |
| Exact Mass | 418.14 |
| IUPAC Name | N-(2,2-diphenylethyl)-3-(prop-2-ynylsulfamoyl)benzamide |
| SMILES | C#CCNS(=O)(=O)c1cccc(C(=O)NCC(c2ccccc2)c2ccccc2)c1 |
| InChI | InChI=1S/C24H22N2O3S/c1-2-16-26-30(28,29)22-15-9-14-21(17-22)24(27)25-18-23(19-10-5-3-6-11-19)20-12-7-4-8-13-20/h1,3-15,17,23,26H,16,18H2,(H,25,27) |
| InChIKey | YJGAPRDFGAHRGQ-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.52 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|