C22H24ClN3O3S — CID 24658958
N-[2-(2-chlorophenyl)-2-pyrrolidin-1-ylethyl]-3-(prop-2-ynylsulfamoyl)benzamide (PubChem CID 24658958) has the molecular formula C22H24ClN3O3S and a molecular weight of 445.97 g/mol. Its IUPAC name is N-[2-(2-chlorophenyl)-2-pyrrolidin-1-ylethyl]-3-(prop-2-ynylsulfamoyl)benzamide.
| Compound Name | N-[2-(2-chlorophenyl)-2-pyrrolidin-1-ylethyl]-3-(prop-2-ynylsulfamoyl)benzamide |
|---|---|
| PubChem CID | 24658958 |
| Molecular Formula | C22H24ClN3O3S |
| Molecular Weight | 445.97 g/mol |
| Exact Mass | 445.12 |
| IUPAC Name | N-[2-(2-chlorophenyl)-2-pyrrolidin-1-ylethyl]-3-(prop-2-ynylsulfamoyl)benzamide |
| SMILES | C#CCNS(=O)(=O)c1cccc(C(=O)NCC(c2ccccc2Cl)N2CCCC2)c1 |
| InChI | InChI=1S/C22H24ClN3O3S/c1-2-12-25-30(28,29)18-9-7-8-17(15-18)22(27)24-16-21(26-13-5-6-14-26)19-10-3-4-11-20(19)23/h1,3-4,7-11,15,21,25H,5-6,12-14,16H2,(H,24,27) |
| InChIKey | XGJSMRYZDPUVAH-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.97 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|