C24H31ClN2O4 — CID 17012011
N-[2-(azepan-1-yl)-2-(2-chlorophenyl)ethyl]-3,4,5-trimethoxybenzamide (PubChem CID 17012011) has the molecular formula C24H31ClN2O4 and a molecular weight of 446.98 g/mol. Its IUPAC name is N-[2-(azepan-1-yl)-2-(2-chlorophenyl)ethyl]-3,4,5-trimethoxybenzamide.
| Compound Name | N-[2-(azepan-1-yl)-2-(2-chlorophenyl)ethyl]-3,4,5-trimethoxybenzamide |
|---|---|
| PubChem CID | 17012011 |
| Molecular Formula | C24H31ClN2O4 |
| Molecular Weight | 446.98 g/mol |
| Exact Mass | 446.20 |
| IUPAC Name | N-[2-(azepan-1-yl)-2-(2-chlorophenyl)ethyl]-3,4,5-trimethoxybenzamide |
| SMILES | COc1cc(C(=O)NCC(c2ccccc2Cl)N2CCCCCC2)cc(OC)c1OC |
| InChI | InChI=1S/C24H31ClN2O4/c1-29-21-14-17(15-22(30-2)23(21)31-3)24(28)26-16-20(18-10-6-7-11-19(18)25)27-12-8-4-5-9-13-27/h6-7,10-11,14-15,20H,4-5,8-9,12-13,16H2,1-3H3,(H,26,28) |
| InChIKey | YIMXEXYQSHTELO-UHFFFAOYSA-N |
| XLogP | 4.71 |
| TPSA | 60.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.98 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |