C22H27ClN2O5 — CID 35041728
N-[(2S)-2-(2-chlorophenyl)-2-morpholin-4-ylethyl]-3,4,5-trimethoxybenzamide (PubChem CID 35041728) has the molecular formula C22H27ClN2O5 and a molecular weight of 434.92 g/mol. Its IUPAC name is N-[(2S)-2-(2-chlorophenyl)-2-morpholin-4-ylethyl]-3,4,5-trimethoxybenzamide.
| Compound Name | N-[(2S)-2-(2-chlorophenyl)-2-morpholin-4-ylethyl]-3,4,5-trimethoxybenzamide |
|---|---|
| PubChem CID | 35041728 |
| Molecular Formula | C22H27ClN2O5 |
| Molecular Weight | 434.92 g/mol |
| Exact Mass | 434.16 |
| IUPAC Name | N-[(2S)-2-(2-chlorophenyl)-2-morpholin-4-ylethyl]-3,4,5-trimethoxybenzamide |
| SMILES | COc1cc(C(=O)NC[C@H](c2ccccc2Cl)N2CCOCC2)cc(OC)c1OC |
| InChI | InChI=1S/C22H27ClN2O5/c1-27-19-12-15(13-20(28-2)21(19)29-3)22(26)24-14-18(25-8-10-30-11-9-25)16-6-4-5-7-17(16)23/h4-7,12-13,18H,8-11,14H2,1-3H3,(H,24,26)/t18-/m1/s1 |
| InChIKey | SKYFZAHBTIVJMI-GOSISDBHSA-N |
| XLogP | 3.17 |
| TPSA | 69.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.92 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |