C20H21Cl3N2O3 — CID 46398915
3,5-dichloro-N-[2-(2-chlorophenyl)-2-morpholin-4-ylethyl]-4-methoxybenzamide (PubChem CID 46398915) has the molecular formula C20H21Cl3N2O3 and a molecular weight of 443.76 g/mol. Its IUPAC name is 3,5-dichloro-N-[2-(2-chlorophenyl)-2-morpholin-4-ylethyl]-4-methoxybenzamide.
| Compound Name | 3,5-dichloro-N-[2-(2-chlorophenyl)-2-morpholin-4-ylethyl]-4-methoxybenzamide |
|---|---|
| PubChem CID | 46398915 |
| Molecular Formula | C20H21Cl3N2O3 |
| Molecular Weight | 443.76 g/mol |
| Exact Mass | 442.06 |
| IUPAC Name | 3,5-dichloro-N-[2-(2-chlorophenyl)-2-morpholin-4-ylethyl]-4-methoxybenzamide |
| SMILES | COc1c(Cl)cc(C(=O)NCC(c2ccccc2Cl)N2CCOCC2)cc1Cl |
| InChI | InChI=1S/C20H21Cl3N2O3/c1-27-19-16(22)10-13(11-17(19)23)20(26)24-12-18(25-6-8-28-9-7-25)14-4-2-3-5-15(14)21/h2-5,10-11,18H,6-9,12H2,1H3,(H,24,26) |
| InChIKey | LPDYYMWOFIWTDX-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.76 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |