C23H28N2O4 — CID 60533855
methyl 4-[[2-(2-methoxyphenyl)-2-piperidin-1-ylethyl]carbamoyl]benzoate (PubChem CID 60533855) has the molecular formula C23H28N2O4 and a molecular weight of 396.49 g/mol. Its IUPAC name is methyl 4-[[2-(2-methoxyphenyl)-2-piperidin-1-ylethyl]carbamoyl]benzoate.
| Compound Name | methyl 4-[[2-(2-methoxyphenyl)-2-piperidin-1-ylethyl]carbamoyl]benzoate |
|---|---|
| PubChem CID | 60533855 |
| Molecular Formula | C23H28N2O4 |
| Molecular Weight | 396.49 g/mol |
| Exact Mass | 396.20 |
| IUPAC Name | methyl 4-[[2-(2-methoxyphenyl)-2-piperidin-1-ylethyl]carbamoyl]benzoate |
| SMILES | COC(=O)c1ccc(C(=O)NCC(c2ccccc2OC)N2CCCCC2)cc1 |
| InChI | InChI=1S/C23H28N2O4/c1-28-21-9-5-4-8-19(21)20(25-14-6-3-7-15-25)16-24-22(26)17-10-12-18(13-11-17)23(27)29-2/h4-5,8-13,20H,3,6-7,14-16H2,1-2H3,(H,24,26) |
| InChIKey | STRZUEHQPSWSQW-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.49 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |